C18H22N3O2+ — CID 135716858
N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1-methylpiperidin-1-ium-2-carboxamide (PubChem CID 135716858) has the molecular formula C18H22N3O2+ and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1-methylpiperidin-1-ium-2-carboxamide.
| Compound Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1-methylpiperidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135716858 |
| Molecular Formula | C18H22N3O2+ |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1-methylpiperidin-1-ium-2-carboxamide |
| SMILES | C[NH+]1CCCCC1C(=O)N/N=C/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C18H21N3O2/c1-21-11-5-4-8-16(21)18(23)20-19-12-15-14-7-3-2-6-13(14)9-10-17(15)22/h2-3,6-7,9-10,12,16,22H,4-5,8,11H2,1H3,(H,20,23)/p+1/b19-12+ |
| InChIKey | FWJVMJSGFFYJCQ-XDHOZWIPSA-O |
| XLogP | 1.06 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|