C28H25N5O4 — CID 135717763
4-[N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-5-phenyl-1H-pyrazol-3-one (PubChem CID 135717763) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is 4-[N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-5-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-5-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135717763 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-[N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]-2-(4-nitrophenyl)-5-phenyl-1H-pyrazol-3-one |
| SMILES | COc1ccc2[nH]cc(CC/N=C(\C)c3c(-c4ccccc4)[nH]n(-c4ccc([N+](=O)[O-])cc4)c3=O)c2c1 |
| InChI | InChI=1S/C28H25N5O4/c1-18(29-15-14-20-17-30-25-13-12-23(37-2)16-24(20)25)26-27(19-6-4-3-5-7-19)31-32(28(26)34)21-8-10-22(11-9-21)33(35)36/h3-13,16-17,30-31H,14-15H2,1-2H3/b29-18+ |
| InChIKey | QNODCZYSXPMQLP-RDRPBHBLSA-N |
| XLogP | 5.28 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|