C32H22ClF3N6NiO2 — CID 135718536
1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]naphthalen-2-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;nickel (PubChem CID 135718536) has the molecular formula C32H22ClF3N6NiO2 and a molecular weight of 673.71 g/mol. Its IUPAC name is 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]naphthalen-2-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;nickel.
| Compound Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]naphthalen-2-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;nickel |
|---|---|
| PubChem CID | 135718536 |
| Molecular Formula | C32H22ClF3N6NiO2 |
| Molecular Weight | 673.71 g/mol |
| Exact Mass | 672.08 |
| IUPAC Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]naphthalen-2-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;nickel |
| SMILES | Cc1cccc(/N=N/c2c(O)ccc3ccccc23)n1.Oc1ccc2ccccc2c1/N=N/c1ncc(C(F)(F)F)cc1Cl.[Ni] |
| InChI | InChI=1S/C16H9ClF3N3O.C16H13N3O.Ni/c17-12-7-10(16(18,19)20)8-21-15(12)23-22-14-11-4-2-1-3-9(11)5-6-13(14)24;1-11-5-4-8-15(17-11)18-19-16-13-7-3-2-6-12(13)9-10-14(16)20;/h1-8,24H;2-10,20H,1H3;/b23-22+;19-18+; |
| InChIKey | WXASLZDNEMZETH-WXCRSBOWSA-N |
| XLogP | 10.69 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.71 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|