C39H22Cl3F3N6O2Zn — CID 135718512
10-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]phenanthren-9-ol;10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;zinc (PubChem CID 135718512) has the molecular formula C39H22Cl3F3N6O2Zn and a molecular weight of 835.39 g/mol. Its IUPAC name is 10-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]phenanthren-9-ol;10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;zinc.
| Compound Name | 10-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]phenanthren-9-ol;10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;zinc |
|---|---|
| PubChem CID | 135718512 |
| Molecular Formula | C39H22Cl3F3N6O2Zn |
| Molecular Weight | 835.39 g/mol |
| Exact Mass | 832.01 |
| IUPAC Name | 10-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]phenanthren-9-ol;10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;zinc |
| SMILES | Oc1c(/N=N/c2ncc(C(F)(F)F)cc2Cl)c2ccccc2c2ccccc12.Oc1c(/N=N/c2ncc(Cl)cc2Cl)c2ccccc2c2ccccc12.[Zn] |
| InChI | InChI=1S/C20H11ClF3N3O.C19H11Cl2N3O.Zn/c21-16-9-11(20(22,23)24)10-25-19(16)27-26-17-14-7-3-1-5-12(14)13-6-2-4-8-15(13)18(17)28;20-11-9-16(21)19(22-10-11)24-23-17-14-7-3-1-5-12(14)13-6-2-4-8-15(13)18(17)25;/h1-10,28H;1-10,25H;/b27-26+;24-23+; |
| InChIKey | XFBRDQJYYVGSKN-BCGPBAODSA-N |
| XLogP | 13.99 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.39 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|