C31H25Cl3F3N7O2Zn — CID 135718542
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]-5-(diethylamino)phenol;1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc (PubChem CID 135718542) has the molecular formula C31H25Cl3F3N7O2Zn and a molecular weight of 756.33 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]-5-(diethylamino)phenol;1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]-5-(diethylamino)phenol;1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc |
|---|---|
| PubChem CID | 135718542 |
| Molecular Formula | C31H25Cl3F3N7O2Zn |
| Molecular Weight | 756.33 g/mol |
| Exact Mass | 753.04 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]diazenyl]-5-(diethylamino)phenol;1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc |
| SMILES | CCN(CC)c1ccc(/N=N/c2ncc(C(F)(F)F)cc2Cl)c(O)c1.Oc1ccc2ccccc2c1/N=N/c1ncc(Cl)cc1Cl.[Zn] |
| InChI | InChI=1S/C16H16ClF3N4O.C15H9Cl2N3O.Zn/c1-3-24(4-2)11-5-6-13(14(25)8-11)22-23-15-12(17)7-10(9-21-15)16(18,19)20;16-10-7-12(17)15(18-8-10)20-19-14-11-4-2-1-3-9(11)5-6-13(14)21;/h5-9,25H,3-4H2,1-2H3;1-8,21H;/b23-22+;20-19+; |
| InChIKey | NQTQUWVJYGOKOY-USANIZQBSA-N |
| XLogP | 11.38 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.33 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|