C36H24Cl2F3N7O3Zn — CID 135718507
10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;1-[[6-methoxy-2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]diazenyl]naphthalen-2-ol;zinc (PubChem CID 135718507) has the molecular formula C36H24Cl2F3N7O3Zn and a molecular weight of 795.92 g/mol. Its IUPAC name is 10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;1-[[6-methoxy-2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]diazenyl]naphthalen-2-ol;zinc.
| Compound Name | 10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;1-[[6-methoxy-2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]diazenyl]naphthalen-2-ol;zinc |
|---|---|
| PubChem CID | 135718507 |
| Molecular Formula | C36H24Cl2F3N7O3Zn |
| Molecular Weight | 795.92 g/mol |
| Exact Mass | 793.06 |
| IUPAC Name | 10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;1-[[6-methoxy-2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]diazenyl]naphthalen-2-ol;zinc |
| SMILES | COc1nc(C)nc(/N=N/c2c(O)ccc3ccccc23)c1C(F)(F)F.Oc1c(/N=N/c2ncc(Cl)cc2Cl)c2ccccc2c2ccccc12.[Zn] |
| InChI | InChI=1S/C19H11Cl2N3O.C17H13F3N4O2.Zn/c20-11-9-16(21)19(22-10-11)24-23-17-14-7-3-1-5-12(14)13-6-2-4-8-15(13)18(17)25;1-9-21-15(13(17(18,19)20)16(22-9)26-2)24-23-14-11-6-4-3-5-10(11)7-8-12(14)25;/h1-10,25H;3-8,25H,1-2H3;/b2*24-23+; |
| InChIKey | QSKYPLAWCOYITJ-GQPWVPPYSA-N |
| XLogP | 11.90 |
| TPSA | 137.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.92 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|