C35H24Cl2N6O2Zn — CID 135718510
10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc (PubChem CID 135718510) has the molecular formula C35H24Cl2N6O2Zn and a molecular weight of 696.91 g/mol. Its IUPAC name is 10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc.
| Compound Name | 10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc |
|---|---|
| PubChem CID | 135718510 |
| Molecular Formula | C35H24Cl2N6O2Zn |
| Molecular Weight | 696.91 g/mol |
| Exact Mass | 694.06 |
| IUPAC Name | 10-[(3,5-dichloro-2-pyridinyl)diazenyl]phenanthren-9-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc |
| SMILES | Cc1cccc(/N=N/c2c(O)ccc3ccccc23)n1.Oc1c(/N=N/c2ncc(Cl)cc2Cl)c2ccccc2c2ccccc12.[Zn] |
| InChI | InChI=1S/C19H11Cl2N3O.C16H13N3O.Zn/c20-11-9-16(21)19(22-10-11)24-23-17-14-7-3-1-5-12(14)13-6-2-4-8-15(13)18(17)25;1-11-5-4-8-15(17-11)18-19-16-13-7-3-2-6-12(13)9-10-14(16)20;/h1-10,25H;2-10,20H,1H3;/b24-23+;19-18+; |
| InChIKey | OBQIPTXIEJQKKC-GNJWUISSSA-N |
| XLogP | 11.48 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.91 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|