C33H26F3N7O3Zn — CID 135718538
1-[[6-methoxy-2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]diazenyl]naphthalen-2-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc (PubChem CID 135718538) has the molecular formula C33H26F3N7O3Zn and a molecular weight of 691.00 g/mol. Its IUPAC name is 1-[[6-methoxy-2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]diazenyl]naphthalen-2-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc.
| Compound Name | 1-[[6-methoxy-2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]diazenyl]naphthalen-2-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc |
|---|---|
| PubChem CID | 135718538 |
| Molecular Formula | C33H26F3N7O3Zn |
| Molecular Weight | 691.00 g/mol |
| Exact Mass | 689.13 |
| IUPAC Name | 1-[[6-methoxy-2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]diazenyl]naphthalen-2-ol;1-[(6-methyl-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc |
| SMILES | COc1nc(C)nc(/N=N/c2c(O)ccc3ccccc23)c1C(F)(F)F.Cc1cccc(/N=N/c2c(O)ccc3ccccc23)n1.[Zn] |
| InChI | InChI=1S/C17H13F3N4O2.C16H13N3O.Zn/c1-9-21-15(13(17(18,19)20)16(22-9)26-2)24-23-14-11-6-4-3-5-10(11)7-8-12(14)25;1-11-5-4-8-15(17-11)18-19-16-13-7-3-2-6-12(13)9-10-14(16)20;/h3-8,25H,1-2H3;2-10,20H,1H3;/b24-23+;19-18+; |
| InChIKey | ZRRHLVUGNIJYDM-GNJWUISSSA-N |
| XLogP | 9.75 |
| TPSA | 137.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.00 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|