C28H22N6O5 — CID 136888463
3-hydroxy-4-[[5-(C-hydroxycarbonimidoyl)-2-methoxyphenyl]diazenyl]-N-(4-hydroxy-2-methylquinazolin-6-yl)naphthalene-2-carboximidic acid (PubChem CID 136888463) has the molecular formula C28H22N6O5 and a molecular weight of 522.52 g/mol. Its IUPAC name is 3-hydroxy-4-[[5-(C-hydroxycarbonimidoyl)-2-methoxyphenyl]diazenyl]-N-(4-hydroxy-2-methylquinazolin-6-yl)naphthalene-2-carboximidic acid.
| Compound Name | 3-hydroxy-4-[[5-(C-hydroxycarbonimidoyl)-2-methoxyphenyl]diazenyl]-N-(4-hydroxy-2-methylquinazolin-6-yl)naphthalene-2-carboximidic acid |
|---|---|
| PubChem CID | 136888463 |
| Molecular Formula | C28H22N6O5 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 3-hydroxy-4-[[5-(C-hydroxycarbonimidoyl)-2-methoxyphenyl]diazenyl]-N-(4-hydroxy-2-methylquinazolin-6-yl)naphthalene-2-carboximidic acid |
| SMILES | [H]/N=C(\O)c1ccc(OC)c(/N=N/c2c(O)c(/C(O)=N/c3ccc4nc(C)nc(O)c4c3)cc3ccccc23)c1 |
| InChI | InChI=1S/C28H22N6O5/c1-14-30-21-9-8-17(13-19(21)27(37)31-14)32-28(38)20-11-15-5-3-4-6-18(15)24(25(20)35)34-33-22-12-16(26(29)36)7-10-23(22)39-2/h3-13,35H,1-2H3,(H2,29,36)(H,32,38)(H,30,31,37)/b34-33+ |
| InChIKey | JSVJFSMFKJZNFF-JEIPZWNWSA-N |
| XLogP | 6.45 |
| TPSA | 176.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|