C25H18N2O4 — CID 164768259
2-(4-anthracen-9-yl-6-methoxypyrimidin-2-yl)benzene-1,3,5-triol (PubChem CID 164768259) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-(4-anthracen-9-yl-6-methoxypyrimidin-2-yl)benzene-1,3,5-triol.
| Compound Name | 2-(4-anthracen-9-yl-6-methoxypyrimidin-2-yl)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 164768259 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-(4-anthracen-9-yl-6-methoxypyrimidin-2-yl)benzene-1,3,5-triol |
| SMILES | COc1cc(-c2c3ccccc3cc3ccccc23)nc(-c2c(O)cc(O)cc2O)n1 |
| InChI | InChI=1S/C25H18N2O4/c1-31-22-13-19(26-25(27-22)24-20(29)11-16(28)12-21(24)30)23-17-8-4-2-6-14(17)10-15-7-3-5-9-18(15)23/h2-13,28-30H,1H3 |
| InChIKey | QVMMATSQNZLCGK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|