C31H22Cl2N6O3Zn — CID 135718520
1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol;1-[(3-methoxy-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc (PubChem CID 135718520) has the molecular formula C31H22Cl2N6O3Zn and a molecular weight of 662.85 g/mol. Its IUPAC name is 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol;1-[(3-methoxy-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc.
| Compound Name | 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol;1-[(3-methoxy-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc |
|---|---|
| PubChem CID | 135718520 |
| Molecular Formula | C31H22Cl2N6O3Zn |
| Molecular Weight | 662.85 g/mol |
| Exact Mass | 660.04 |
| IUPAC Name | 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol;1-[(3-methoxy-2-pyridinyl)diazenyl]naphthalen-2-ol;zinc |
| SMILES | COc1cccnc1/N=N/c1c(O)ccc2ccccc12.Oc1ccc2ccccc2c1/N=N/c1ncc(Cl)cc1Cl.[Zn] |
| InChI | InChI=1S/C16H13N3O2.C15H9Cl2N3O.Zn/c1-21-14-7-4-10-17-16(14)19-18-15-12-6-3-2-5-11(12)8-9-13(15)20;16-10-7-12(17)15(18-8-10)20-19-14-11-4-2-1-3-9(11)5-6-13(14)21;/h2-10,20H,1H3;1-8,21H;/b19-18+;20-19+; |
| InChIKey | TZNPTDCJRRISKF-DWULKELFSA-N |
| XLogP | 10.02 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.85 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|