C6H10N4O4S2 — CID 135723033
2-[(E)-N-hydroxy-C-[(E)-hydroxyiminomethyl]carbonimidoyl]sulfanylethyl (1E,2E)-N-hydroxy-2-hydroxyiminoethanimidothioate (PubChem CID 135723033) has the molecular formula C6H10N4O4S2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[(E)-N-hydroxy-C-[(E)-hydroxyiminomethyl]carbonimidoyl]sulfanylethyl (1E,2E)-N-hydroxy-2-hydroxyiminoethanimidothioate.
| Compound Name | 2-[(E)-N-hydroxy-C-[(E)-hydroxyiminomethyl]carbonimidoyl]sulfanylethyl (1E,2E)-N-hydroxy-2-hydroxyiminoethanimidothioate |
|---|---|
| PubChem CID | 135723033 |
| Molecular Formula | C6H10N4O4S2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-[(E)-N-hydroxy-C-[(E)-hydroxyiminomethyl]carbonimidoyl]sulfanylethyl (1E,2E)-N-hydroxy-2-hydroxyiminoethanimidothioate |
| SMILES | O/N=C/C(=N\O)SCCSC(/C=N/O)=N/O |
| InChI | InChI=1S/C6H10N4O4S2/c11-7-3-5(9-13)15-1-2-16-6(10-14)4-8-12/h3-4,11-14H,1-2H2/b7-3+,8-4+,9-5+,10-6+ |
| InChIKey | VSORVPDDIXGDTR-JMFUVXGRSA-N |
| XLogP | 0.95 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|