C15H19N3O — CID 135723926
(4E)-4-(1H-pyrrol-2-ylmethylidene)-3-(2,2,3,3-tetramethylcyclopropyl)-1H-pyrazol-5-one (PubChem CID 135723926) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is (4E)-4-(1H-pyrrol-2-ylmethylidene)-3-(2,2,3,3-tetramethylcyclopropyl)-1H-pyrazol-5-one.
| Compound Name | (4E)-4-(1H-pyrrol-2-ylmethylidene)-3-(2,2,3,3-tetramethylcyclopropyl)-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135723926 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (4E)-4-(1H-pyrrol-2-ylmethylidene)-3-(2,2,3,3-tetramethylcyclopropyl)-1H-pyrazol-5-one |
| SMILES | CC1(C)C(C2=NNC(=O)/C2=C/c2ccc[nH]2)C1(C)C |
| InChI | InChI=1S/C15H19N3O/c1-14(2)12(15(14,3)4)11-10(13(19)18-17-11)8-9-6-5-7-16-9/h5-8,12,16H,1-4H3,(H,18,19)/b10-8+ |
| InChIKey | CUTBBGPBSYAOLA-CSKARUKUSA-N |
| XLogP | 2.57 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|