C19H24N6O — CID 135724099
(4E)-4-[[4-(diethylaminomethyl)-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-4-yl-1H-pyrazol-5-one (PubChem CID 135724099) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is (4E)-4-[[4-(diethylaminomethyl)-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-4-yl-1H-pyrazol-5-one.
| Compound Name | (4E)-4-[[4-(diethylaminomethyl)-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-4-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135724099 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (4E)-4-[[4-(diethylaminomethyl)-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-4-yl-1H-pyrazol-5-one |
| SMILES | CCN(CC)Cc1c(C)[nH]c(/C=C2/C(=O)NN=C2c2ccnnc2)c1C |
| InChI | InChI=1S/C19H24N6O/c1-5-25(6-2)11-16-12(3)17(22-13(16)4)9-15-18(23-24-19(15)26)14-7-8-20-21-10-14/h7-10,22H,5-6,11H2,1-4H3,(H,24,26)/b15-9+ |
| InChIKey | VZPHWGQTQQYFHB-OQLLNIDSSA-N |
| XLogP | 2.18 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|