C17H17N5O3 — CID 135724204
3-[2,4-dimethyl-5-[(E)-(5-oxo-3-pyridazin-3-yl-1H-pyrazol-4-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid (PubChem CID 135724204) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 3-[2,4-dimethyl-5-[(E)-(5-oxo-3-pyridazin-3-yl-1H-pyrazol-4-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[2,4-dimethyl-5-[(E)-(5-oxo-3-pyridazin-3-yl-1H-pyrazol-4-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 135724204 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-[2,4-dimethyl-5-[(E)-(5-oxo-3-pyridazin-3-yl-1H-pyrazol-4-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid |
| SMILES | Cc1[nH]c(/C=C2/C(=O)NN=C2c2cccnn2)c(C)c1CCC(=O)O |
| InChI | InChI=1S/C17H17N5O3/c1-9-11(5-6-15(23)24)10(2)19-14(9)8-12-16(21-22-17(12)25)13-4-3-7-18-20-13/h3-4,7-8,19H,5-6H2,1-2H3,(H,22,25)(H,23,24)/b12-8+ |
| InChIKey | KPUSKRCGVLXKOE-XYOKQWHBSA-N |
| XLogP | 1.36 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|