C16H16N6O3 — CID 135723969
3-[2,4-dimethyl-5-[(E)-[5-oxo-3-(1,2,4-triazin-3-yl)-1H-pyrazol-4-ylidene]methyl]-1H-pyrrol-3-yl]propanoic acid (PubChem CID 135723969) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 3-[2,4-dimethyl-5-[(E)-[5-oxo-3-(1,2,4-triazin-3-yl)-1H-pyrazol-4-ylidene]methyl]-1H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[2,4-dimethyl-5-[(E)-[5-oxo-3-(1,2,4-triazin-3-yl)-1H-pyrazol-4-ylidene]methyl]-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 135723969 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-[2,4-dimethyl-5-[(E)-[5-oxo-3-(1,2,4-triazin-3-yl)-1H-pyrazol-4-ylidene]methyl]-1H-pyrrol-3-yl]propanoic acid |
| SMILES | Cc1[nH]c(/C=C2/C(=O)NN=C2c2nccnn2)c(C)c1CCC(=O)O |
| InChI | InChI=1S/C16H16N6O3/c1-8-10(3-4-13(23)24)9(2)19-12(8)7-11-14(20-22-16(11)25)15-17-5-6-18-21-15/h5-7,19H,3-4H2,1-2H3,(H,22,25)(H,23,24)/b11-7+ |
| InChIKey | BKBMYKRNOMUQQV-YRNVUSSQSA-N |
| XLogP | 0.75 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|