C23H29N7O — CID 135724076
(4E)-4-[[4-[4-(cyclobutylamino)butyl]-3-cyclopropyl-5-methyl-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one (PubChem CID 135724076) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is (4E)-4-[[4-[4-(cyclobutylamino)butyl]-3-cyclopropyl-5-methyl-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one.
| Compound Name | (4E)-4-[[4-[4-(cyclobutylamino)butyl]-3-cyclopropyl-5-methyl-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135724076 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | (4E)-4-[[4-[4-(cyclobutylamino)butyl]-3-cyclopropyl-5-methyl-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one |
| SMILES | Cc1[nH]c(/C=C2/C(=O)NN=C2c2nccnn2)c(C2CC2)c1CCCCNC1CCC1 |
| InChI | InChI=1S/C23H29N7O/c1-14-17(7-2-3-10-24-16-5-4-6-16)20(15-8-9-15)19(27-14)13-18-21(28-30-23(18)31)22-25-11-12-26-29-22/h11-13,15-16,24,27H,2-10H2,1H3,(H,30,31)/b18-13+ |
| InChIKey | KTQALQVLECSVMI-QGOAFFKASA-N |
| XLogP | 2.77 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|