C16H13ClN2O3 — CID 135726299
2-(4-chlorophenyl)-5-(2-hydroxy-5-methoxyphenyl)-4H-pyrazol-3-one (PubChem CID 135726299) has the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(2-hydroxy-5-methoxyphenyl)-4H-pyrazol-3-one.
| Compound Name | 2-(4-chlorophenyl)-5-(2-hydroxy-5-methoxyphenyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 135726299 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(2-hydroxy-5-methoxyphenyl)-4H-pyrazol-3-one |
| SMILES | COc1ccc(O)c(C2=NN(c3ccc(Cl)cc3)C(=O)C2)c1 |
| InChI | InChI=1S/C16H13ClN2O3/c1-22-12-6-7-15(20)13(8-12)14-9-16(21)19(18-14)11-4-2-10(17)3-5-11/h2-8,20H,9H2,1H3 |
| InChIKey | QEKAVWMNOOBTEK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|