C21H18N2O2 — CID 135727187
2-(1H-benzimidazol-2-yl)-3-hydroxy-5-[(E)-2-phenylethenyl]cyclohex-2-en-1-one (PubChem CID 135727187) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-hydroxy-5-[(E)-2-phenylethenyl]cyclohex-2-en-1-one.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-5-[(E)-2-phenylethenyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135727187 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-5-[(E)-2-phenylethenyl]cyclohex-2-en-1-one |
| SMILES | O=C1CC(/C=C/c2ccccc2)CC(O)=C1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H18N2O2/c24-18-12-15(11-10-14-6-2-1-3-7-14)13-19(25)20(18)21-22-16-8-4-5-9-17(16)23-21/h1-11,15,24H,12-13H2,(H,22,23)/b11-10+ |
| InChIKey | VYAOSPLWFAMTDV-ZHACJKMWSA-N |
| XLogP | 4.52 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |