C13H16N6O5 — CID 135733107
propan-2-yl 1-ethyl-4-[(5-nitro-1H-pyrazole-3-carbonyl)amino]pyrazole-3-carboxylate (PubChem CID 135733107) has the molecular formula C13H16N6O5 and a molecular weight of 336.31 g/mol. Its IUPAC name is propan-2-yl 1-ethyl-4-[(5-nitro-1H-pyrazole-3-carbonyl)amino]pyrazole-3-carboxylate.
| Compound Name | propan-2-yl 1-ethyl-4-[(5-nitro-1H-pyrazole-3-carbonyl)amino]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 135733107 |
| Molecular Formula | C13H16N6O5 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | propan-2-yl 1-ethyl-4-[(5-nitro-1H-pyrazole-3-carbonyl)amino]pyrazole-3-carboxylate |
| SMILES | CCn1cc(NC(=O)c2cc([N+](=O)[O-])[nH]n2)c(C(=O)OC(C)C)n1 |
| InChI | InChI=1S/C13H16N6O5/c1-4-18-6-9(11(17-18)13(21)24-7(2)3)14-12(20)8-5-10(16-15-8)19(22)23/h5-7H,4H2,1-3H3,(H,14,20)(H,15,16) |
| InChIKey | XKYKIDSEKZMBNQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|