C13H21N3O3 — CID 19404584
propan-2-yl 4-(butanoylamino)-1-ethylpyrazole-3-carboxylate (PubChem CID 19404584) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is propan-2-yl 4-(butanoylamino)-1-ethylpyrazole-3-carboxylate.
| Compound Name | propan-2-yl 4-(butanoylamino)-1-ethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19404584 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | propan-2-yl 4-(butanoylamino)-1-ethylpyrazole-3-carboxylate |
| SMILES | CCCC(=O)Nc1cn(CC)nc1C(=O)OC(C)C |
| InChI | InChI=1S/C13H21N3O3/c1-5-7-11(17)14-10-8-16(6-2)15-12(10)13(18)19-9(3)4/h8-9H,5-7H2,1-4H3,(H,14,17) |
| InChIKey | ADUXCJGGCCNYPE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |