C17H20N4O6 — CID 19404379
propan-2-yl 1-ethyl-4-[(4-methoxy-3-nitrobenzoyl)amino]pyrazole-3-carboxylate (PubChem CID 19404379) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is propan-2-yl 1-ethyl-4-[(4-methoxy-3-nitrobenzoyl)amino]pyrazole-3-carboxylate.
| Compound Name | propan-2-yl 1-ethyl-4-[(4-methoxy-3-nitrobenzoyl)amino]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19404379 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | propan-2-yl 1-ethyl-4-[(4-methoxy-3-nitrobenzoyl)amino]pyrazole-3-carboxylate |
| SMILES | CCn1cc(NC(=O)c2ccc(OC)c([N+](=O)[O-])c2)c(C(=O)OC(C)C)n1 |
| InChI | InChI=1S/C17H20N4O6/c1-5-20-9-12(15(19-20)17(23)27-10(2)3)18-16(22)11-6-7-14(26-4)13(8-11)21(24)25/h6-10H,5H2,1-4H3,(H,18,22) |
| InChIKey | ORPYBWJTWJRBOZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|