C9H14N2O3 — CID 135733779
5-(ethylperoxymethyl)-2,4-dimethyl-1H-pyrimidin-6-one (PubChem CID 135733779) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-(ethylperoxymethyl)-2,4-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 5-(ethylperoxymethyl)-2,4-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135733779 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 5-(ethylperoxymethyl)-2,4-dimethyl-1H-pyrimidin-6-one |
| SMILES | CCOOCc1c(C)nc(C)[nH]c1=O |
| InChI | InChI=1S/C9H14N2O3/c1-4-13-14-5-8-6(2)10-7(3)11-9(8)12/h4-5H2,1-3H3,(H,10,11,12) |
| InChIKey | PSECSJIEEIZHBU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|