C24H20ClN3O3 — CID 135734024
(Z)-2-(1H-benzimidazol-2-yl)-N-benzyl-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enamide (PubChem CID 135734024) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-N-benzyl-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-N-benzyl-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 135734024 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-N-benzyl-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C(=O)NCc2ccccc2)c2nc3ccccc3[nH]2)cc(Cl)c1O |
| InChI | InChI=1S/C24H20ClN3O3/c1-31-21-13-16(12-18(25)22(21)29)11-17(23-27-19-9-5-6-10-20(19)28-23)24(30)26-14-15-7-3-2-4-8-15/h2-13,29H,14H2,1H3,(H,26,30)(H,27,28)/b17-11- |
| InChIKey | KPZDOUBLWRPWDE-BOPFTXTBSA-N |
| XLogP | 4.79 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|