C21H15ClN4O4 — CID 6223723
(E)-2-(1H-benzimidazol-2-yl)-3-(4-chloro-3-nitrophenyl)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 6223723) has the molecular formula C21H15ClN4O4 and a molecular weight of 422.83 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-(4-chloro-3-nitrophenyl)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-(4-chloro-3-nitrophenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6223723 |
| Molecular Formula | C21H15ClN4O4 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-(4-chloro-3-nitrophenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(NCc1ccco1)/C(=C/c1ccc(Cl)c([N+](=O)[O-])c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H15ClN4O4/c22-16-8-7-13(11-19(16)26(28)29)10-15(21(27)23-12-14-4-3-9-30-14)20-24-17-5-1-2-6-18(17)25-20/h1-11H,12H2,(H,23,27)(H,24,25)/b15-10+ |
| InChIKey | RTCWSQHJIZYNRI-XNTDXEJSSA-N |
| XLogP | 4.57 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|