C19H12F3N3O — CID 135734238
1,3-diphenyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135734238) has the molecular formula C19H12F3N3O and a molecular weight of 355.32 g/mol. Its IUPAC name is 1,3-diphenyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 1,3-diphenyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135734238 |
| Molecular Formula | C19H12F3N3O |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1,3-diphenyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | O=c1cc(C(F)(F)F)c2c(-c3ccccc3)nn(-c3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C19H12F3N3O/c20-19(21,22)14-11-15(26)23-18-16(14)17(12-7-3-1-4-8-12)24-25(18)13-9-5-2-6-10-13/h1-11H,(H,23,26) |
| InChIKey | SAYNOZQFDSIVSJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |