C18H12BrClN2O3 — CID 135736499
methyl 2-[(Z)-2-(4-bromophenyl)-1-chloroethenyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 135736499) has the molecular formula C18H12BrClN2O3 and a molecular weight of 419.66 g/mol. Its IUPAC name is methyl 2-[(Z)-2-(4-bromophenyl)-1-chloroethenyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 2-[(Z)-2-(4-bromophenyl)-1-chloroethenyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135736499 |
| Molecular Formula | C18H12BrClN2O3 |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | methyl 2-[(Z)-2-(4-bromophenyl)-1-chloroethenyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)[nH]c(/C(Cl)=C/c3ccc(Br)cc3)nc2c1 |
| InChI | InChI=1S/C18H12BrClN2O3/c1-25-18(24)11-4-7-13-15(9-11)21-16(22-17(13)23)14(20)8-10-2-5-12(19)6-3-10/h2-9H,1H3,(H,21,22,23)/b14-8- |
| InChIKey | LTEBXEONKOKQTE-ZSOIEALJSA-N |
| XLogP | 4.21 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |