C21H17ClN2O4 — CID 135991489
methyl 2-[(Z)-1-chloro-2-(4-prop-2-enoxyphenyl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 135991489) has the molecular formula C21H17ClN2O4 and a molecular weight of 396.83 g/mol. Its IUPAC name is methyl 2-[(Z)-1-chloro-2-(4-prop-2-enoxyphenyl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 2-[(Z)-1-chloro-2-(4-prop-2-enoxyphenyl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135991489 |
| Molecular Formula | C21H17ClN2O4 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | methyl 2-[(Z)-1-chloro-2-(4-prop-2-enoxyphenyl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | C=CCOc1ccc(/C=C(\Cl)c2nc3cc(C(=O)OC)ccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H17ClN2O4/c1-3-10-28-15-7-4-13(5-8-15)11-17(22)19-23-18-12-14(21(26)27-2)6-9-16(18)20(25)24-19/h3-9,11-12H,1,10H2,2H3,(H,23,24,25)/b17-11- |
| InChIKey | DGOMTCBCNUVBDV-BOPFTXTBSA-N |
| XLogP | 4.01 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|