C19H12ClN3O3 — CID 137309548
methyl 2-[(Z)-1-chloro-2-(3-cyanophenyl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 137309548) has the molecular formula C19H12ClN3O3 and a molecular weight of 365.78 g/mol. Its IUPAC name is methyl 2-[(Z)-1-chloro-2-(3-cyanophenyl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 2-[(Z)-1-chloro-2-(3-cyanophenyl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 137309548 |
| Molecular Formula | C19H12ClN3O3 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | methyl 2-[(Z)-1-chloro-2-(3-cyanophenyl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)[nH]c(/C(Cl)=C/c3cccc(C#N)c3)nc2c1 |
| InChI | InChI=1S/C19H12ClN3O3/c1-26-19(25)13-5-6-14-16(9-13)22-17(23-18(14)24)15(20)8-11-3-2-4-12(7-11)10-21/h2-9H,1H3,(H,22,23,24)/b15-8- |
| InChIKey | IPXULQPEGVDXCO-NVNXTCNLSA-N |
| XLogP | 3.32 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |