C14H16ClN5O3 — CID 135738262
N-(5-chloro-1-ethyl-2-hydroxyindol-3-yl)imino-4-hydrazinyl-4-oxobutanamide (PubChem CID 135738262) has the molecular formula C14H16ClN5O3 and a molecular weight of 337.77 g/mol. Its IUPAC name is N-(5-chloro-1-ethyl-2-hydroxyindol-3-yl)imino-4-hydrazinyl-4-oxobutanamide.
| Compound Name | N-(5-chloro-1-ethyl-2-hydroxyindol-3-yl)imino-4-hydrazinyl-4-oxobutanamide |
|---|---|
| PubChem CID | 135738262 |
| Molecular Formula | C14H16ClN5O3 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(5-chloro-1-ethyl-2-hydroxyindol-3-yl)imino-4-hydrazinyl-4-oxobutanamide |
| SMILES | CCn1c(O)c(/N=N/C(=O)CCC(=O)NN)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H16ClN5O3/c1-2-20-10-4-3-8(15)7-9(10)13(14(20)23)19-18-12(22)6-5-11(21)17-16/h3-4,7,23H,2,5-6,16H2,1H3,(H,17,21)/b19-18+ |
| InChIKey | NCDXMJNDTMVFNW-VHEBQXMUSA-N |
| XLogP | 2.40 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|