C20H13N3O4 — CID 135740312
6-hydroxy-5-phenyldiazenyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione (PubChem CID 135740312) has the molecular formula C20H13N3O4 and a molecular weight of 359.34 g/mol. Its IUPAC name is 6-hydroxy-5-phenyldiazenyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione.
| Compound Name | 6-hydroxy-5-phenyldiazenyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione |
|---|---|
| PubChem CID | 135740312 |
| Molecular Formula | C20H13N3O4 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 6-hydroxy-5-phenyldiazenyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione |
| SMILES | O=c1oc2c(c(O)c1/N=N/c1ccccc1)c(=O)n1c3c(cccc23)CC1 |
| InChI | InChI=1S/C20H13N3O4/c24-17-14-18(13-8-4-5-11-9-10-23(16(11)13)19(14)25)27-20(26)15(17)22-21-12-6-2-1-3-7-12/h1-8,24H,9-10H2/b22-21+ |
| InChIKey | DEPQEMPQLAPUDJ-QURGRASLSA-N |
| XLogP | 3.79 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|