About 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide
3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide (PubChem CID 135740316) has the molecular formula C9H9N5O3
and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide.
Molecular Properties
| Compound Name | 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide |
| PubChem CID | 135740316 |
| Molecular Formula | C9H9N5O3 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide |
| SMILES | N/C(=N\O)c1c(N)[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C9H9N5O3/c10-8(12-15)7-9(11)14(17)6-4-2-1-3-5(6)13(7)16/h1-4,15H,11H2,(H2,10,12) |
| InChIKey | OXAXXPTUBUZEJA-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide?
The IUPAC name of 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide (CID 135740316) is 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide.
What is the SMILES notation for 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide?
The canonical SMILES for 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide is N/C(=N\O)c1c(N)[n+]([O-])c2ccccc2[n+]1[O-].
What is the InChIKey of 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide?
The InChIKey is OXAXXPTUBUZEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5O3/c10-8(12-15)7-9(11)14(17)6-4-2-1-3-5(6)13(7)16/h1-4,15H,11H2,(H2,10,12).
What are the key properties of 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide?
3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide has a molecular weight of 235.20 g/mol, XLogP of -1.22, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide is sourced from PubChem (CID 135740316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).