C9H9N5O3 — CID 135740316
3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide (PubChem CID 135740316) has the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide.
| Compound Name | 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide |
|---|---|
| PubChem CID | 135740316 |
| Molecular Formula | C9H9N5O3 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-amino-N'-hydroxy-1,4-dioxidoquinoxaline-1,4-diium-2-carboximidamide |
| SMILES | N/C(=N\O)c1c(N)[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C9H9N5O3/c10-8(12-15)7-9(11)14(17)6-4-2-1-3-5(6)13(7)16/h1-4,15H,11H2,(H2,10,12) |
| InChIKey | OXAXXPTUBUZEJA-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|