C12H11NO5 — CID 135740726
3-[3-[carboxy(hydroxy)methyl]-2-cyanophenyl]propanoic acid (PubChem CID 135740726) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 3-[3-[carboxy(hydroxy)methyl]-2-cyanophenyl]propanoic acid.
| Compound Name | 3-[3-[carboxy(hydroxy)methyl]-2-cyanophenyl]propanoic acid |
|---|---|
| PubChem CID | 135740726 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-[3-[carboxy(hydroxy)methyl]-2-cyanophenyl]propanoic acid |
| SMILES | N#Cc1c(CCC(=O)O)cccc1C(O)C(=O)O |
| InChI | InChI=1S/C12H11NO5/c13-6-9-7(4-5-10(14)15)2-1-3-8(9)11(16)12(17)18/h1-3,11,16H,4-5H2,(H,14,15)(H,17,18) |
| InChIKey | FODOOJRATLYHNG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |