C7H7N3O — CID 135741818
5-methyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 135741818) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is 5-methyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 5-methyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135741818 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 5-methyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1c[nH]c2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C7H7N3O/c1-4-2-8-6-5(4)7(11)10-3-9-6/h2-3H,1H3,(H2,8,9,10,11) |
| InChIKey | GEXRTPPPJWUZFK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |