C13H19N3O6 — CID 135745807
ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate (PubChem CID 135745807) has the molecular formula C13H19N3O6 and a molecular weight of 313.31 g/mol. Its IUPAC name is ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate.
| Compound Name | ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 135745807 |
| Molecular Formula | C13H19N3O6 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNC(=O)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N3O6/c1-2-22-8(17)6-4-3-5-7-14-10(18)9-11(19)15-13(21)16-12(9)20/h2-7H2,1H3,(H,14,18)(H3,15,16,19,20,21) |
| InChIKey | KOVFEFQXYKYUMT-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|