About ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate
ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate (PubChem CID 135745807) has the molecular formula C13H19N3O6
and a molecular weight of 313.31 g/mol. Its IUPAC name is ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate.
Molecular Properties
| Compound Name | ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate |
| PubChem CID | 135745807 |
| Molecular Formula | C13H19N3O6 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNC(=O)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N3O6/c1-2-22-8(17)6-4-3-5-7-14-10(18)9-11(19)15-13(21)16-12(9)20/h2-7H2,1H3,(H,14,18)(H3,15,16,19,20,21) |
| InChIKey | KOVFEFQXYKYUMT-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate?
The IUPAC name of ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate (CID 135745807) is ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate.
What is the SMILES notation for ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate?
The canonical SMILES for ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate is CCOC(=O)CCCCCNC(=O)c1c(O)[nH]c(=O)[nH]c1=O.
What is the InChIKey of ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate?
The InChIKey is KOVFEFQXYKYUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O6/c1-2-22-8(17)6-4-3-5-7-14-10(18)9-11(19)15-13(21)16-12(9)20/h2-7H2,1H3,(H,14,18)(H3,15,16,19,20,21).
What are the key properties of ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate?
ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate has a molecular weight of 313.31 g/mol, XLogP of -0.38, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[(6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate is sourced from PubChem (CID 135745807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).