methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate

C12H17N3O5 — CID 43404601

IUPACmethyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate
SMILESCOC(=O)CCCCCNC(=O)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C12H17N3O5/c1-20-9(16)5-3-2-4-6-13-10(17)8-7-14-12(19)15-11(8)18/h7H,2-6H2,1H3,(H,13,17)(H2,14,15,18,19)
InChIKeyZNEMKQNNLBSSJO-UHFFFAOYSA-N
MW283.28 g/mol
LogP-0.47
Rot. Bonds7

About methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate

methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate (PubChem CID 43404601) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate.

Molecular Properties

Compound Namemethyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate
PubChem CID43404601
Molecular FormulaC12H17N3O5
Molecular Weight283.28 g/mol
Exact Mass283.12
IUPAC Namemethyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate
SMILESCOC(=O)CCCCCNC(=O)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C12H17N3O5/c1-20-9(16)5-3-2-4-6-13-10(17)8-7-14-12(19)15-11(8)18/h7H,2-6H2,1H3,(H,13,17)(H2,14,15,18,19)
InChIKeyZNEMKQNNLBSSJO-UHFFFAOYSA-N
XLogP-0.47
TPSA121.12 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.28
LogP ≤ 5-0.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate?
The IUPAC name of methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate (CID 43404601) is methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate.
What is the SMILES notation for methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate?
The canonical SMILES for methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate is COC(=O)CCCCCNC(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate?
The InChIKey is ZNEMKQNNLBSSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O5/c1-20-9(16)5-3-2-4-6-13-10(17)8-7-14-12(19)15-11(8)18/h7H,2-6H2,1H3,(H,13,17)(H2,14,15,18,19).
What are the key properties of methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate?
methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate has a molecular weight of 283.28 g/mol, XLogP of -0.47, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoate is sourced from PubChem (CID 43404601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).