C12H17N3O5 — CID 28773376
7-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]heptanoic acid (PubChem CID 28773376) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 7-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]heptanoic acid.
| Compound Name | 7-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 28773376 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 7-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N3O5/c16-9(17)5-3-1-2-4-6-13-10(18)8-7-14-12(20)15-11(8)19/h7H,1-6H2,(H,13,18)(H,16,17)(H2,14,15,19,20) |
| InChIKey | NAEHQMWATOOUAH-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|