C15H22N2O5 — CID 169034374
[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate (PubChem CID 169034374) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is [6-(5-methyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate.
| Compound Name | [6-(5-methyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 169034374 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [6-(5-methyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate |
| SMILES | Cc1cn(C(=O)CCCCCOC(=O)C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H22N2O5/c1-10(2)14(20)22-8-6-4-5-7-12(18)17-9-11(3)13(19)16-15(17)21/h9-10H,4-8H2,1-3H3,(H,16,19,21) |
| InChIKey | GBRCCDJYEMHHAE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|