C16H10ClN2O3S- — CID 135745942
2-[(Z)-1-chloro-2-(5-methylthiophen-2-yl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 135745942) has the molecular formula C16H10ClN2O3S- and a molecular weight of 345.79 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(5-methylthiophen-2-yl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | 2-[(Z)-1-chloro-2-(5-methylthiophen-2-yl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135745942 |
| Molecular Formula | C16H10ClN2O3S- |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(5-methylthiophen-2-yl)ethenyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | Cc1ccc(/C=C(\Cl)c2nc3cc(C(=O)[O-])ccc3c(=O)[nH]2)s1 |
| InChI | InChI=1S/C16H11ClN2O3S/c1-8-2-4-10(23-8)7-12(17)14-18-13-6-9(16(21)22)3-5-11(13)15(20)19-14/h2-7H,1H3,(H,21,22)(H,18,19,20)/p-1/b12-7- |
| InChIKey | XEDJAYLDKKGKAW-GHXNOFRVSA-M |
| XLogP | 2.39 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |