C13H8ClN3O3S — CID 135746074
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 6-chloropyridine-3-carboxylate (PubChem CID 135746074) has the molecular formula C13H8ClN3O3S and a molecular weight of 321.75 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 6-chloropyridine-3-carboxylate.
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 135746074 |
| Molecular Formula | C13H8ClN3O3S |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 6-chloropyridine-3-carboxylate |
| SMILES | O=C(OCc1nc2ccsc2c(=O)[nH]1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H8ClN3O3S/c14-9-2-1-7(5-15-9)13(19)20-6-10-16-8-3-4-21-11(8)12(18)17-10/h1-5H,6H2,(H,16,17,18) |
| InChIKey | FKGATNROAKKHDT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|