C19H16ClN3O3S — CID 24978738
[2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 6-chloropyridine-3-carboxylate (PubChem CID 24978738) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is [2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 24978738 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 6-chloropyridine-3-carboxylate |
| SMILES | Cc1ccccc1NC(=O)Cc1nc(COC(=O)c2ccc(Cl)nc2)cs1 |
| InChI | InChI=1S/C19H16ClN3O3S/c1-12-4-2-3-5-15(12)23-17(24)8-18-22-14(11-27-18)10-26-19(25)13-6-7-16(20)21-9-13/h2-7,9,11H,8,10H2,1H3,(H,23,24) |
| InChIKey | GJRQBUKFRNZGCV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|