C17H12ClN3O3S — CID 2361839
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloropyridine-3-carboxylate (PubChem CID 2361839) has the molecular formula C17H12ClN3O3S and a molecular weight of 373.82 g/mol. Its IUPAC name is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2361839 |
| Molecular Formula | C17H12ClN3O3S |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1Cl)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H12ClN3O3S/c18-15-12(7-4-8-19-15)16(23)24-9-14(22)21-17-20-13(10-25-17)11-5-2-1-3-6-11/h1-8,10H,9H2,(H,20,21,22) |
| InChIKey | PZYCVTQMWKZRSM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|