C14H12ClN3O3S — CID 2587834
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate (PubChem CID 2587834) has the molecular formula C14H12ClN3O3S and a molecular weight of 337.79 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 2587834 |
| Molecular Formula | C14H12ClN3O3S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
| SMILES | CSc1ncccc1C(=O)OCC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H12ClN3O3S/c1-22-13-10(3-2-6-16-13)14(20)21-8-12(19)18-11-5-4-9(15)7-17-11/h2-7H,8H2,1H3,(H,17,18,19) |
| InChIKey | OZDCLJOHEZBQNJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |