C22H16IN2O2+ — CID 135746903
(4-hydroxy-6-oxo-1,2-diphenylpyrimidin-5-yl)-phenyliodanium (PubChem CID 135746903) has the molecular formula C22H16IN2O2+ and a molecular weight of 467.29 g/mol. Its IUPAC name is (4-hydroxy-6-oxo-1,2-diphenylpyrimidin-5-yl)-phenyliodanium.
| Compound Name | (4-hydroxy-6-oxo-1,2-diphenylpyrimidin-5-yl)-phenyliodanium |
|---|---|
| PubChem CID | 135746903 |
| Molecular Formula | C22H16IN2O2+ |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | (4-hydroxy-6-oxo-1,2-diphenylpyrimidin-5-yl)-phenyliodanium |
| SMILES | O=c1c([I+]c2ccccc2)c(O)nc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C22H15IN2O2/c26-21-19(23-17-12-6-2-7-13-17)22(27)25(18-14-8-3-9-15-18)20(24-21)16-10-4-1-5-11-16/h1-15H/p+1 |
| InChIKey | XWVHUTNOFANHGW-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|