C21H14ClN3O4 — CID 135747838
N-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-2-(furan-2-yl)quinoline-4-carboxamide (PubChem CID 135747838) has the molecular formula C21H14ClN3O4 and a molecular weight of 407.81 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-2-(furan-2-yl)quinoline-4-carboxamide.
| Compound Name | N-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-2-(furan-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 135747838 |
| Molecular Formula | C21H14ClN3O4 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-2-(furan-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1cc(O)c(O)c(Cl)c1)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C21H14ClN3O4/c22-15-8-12(9-18(26)20(15)27)11-23-25-21(28)14-10-17(19-6-3-7-29-19)24-16-5-2-1-4-13(14)16/h1-11,26-27H,(H,25,28)/b23-11+ |
| InChIKey | JHIMJGPJJSQPIR-FOKLQQMPSA-N |
| XLogP | 4.32 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|