C18H24Cl2N4O3S — CID 135753330
4-[3-chloro-5-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]-N'-hydroxy-1,3-thiazole-2-carboximidamide;hydrochloride (PubChem CID 135753330) has the molecular formula C18H24Cl2N4O3S and a molecular weight of 447.39 g/mol. Its IUPAC name is 4-[3-chloro-5-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]-N'-hydroxy-1,3-thiazole-2-carboximidamide;hydrochloride.
| Compound Name | 4-[3-chloro-5-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]-N'-hydroxy-1,3-thiazole-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 135753330 |
| Molecular Formula | C18H24Cl2N4O3S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 4-[3-chloro-5-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]-N'-hydroxy-1,3-thiazole-2-carboximidamide;hydrochloride |
| SMILES | COc1cc(-c2csc(/C(N)=N\O)n2)cc(Cl)c1OCCN1CCCCC1.Cl |
| InChI | InChI=1S/C18H23ClN4O3S.ClH/c1-25-15-10-12(14-11-27-18(21-14)17(20)22-24)9-13(19)16(15)26-8-7-23-5-3-2-4-6-23;/h9-11,24H,2-8H2,1H3,(H2,20,22);1H |
| InChIKey | WJGWVSOXKCYADI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|