C15H15NO6 — CID 135754072
ethyl 5-[(2E)-2-(2,4-dihydroxyphenyl)-2-hydroxyiminoethyl]furan-2-carboxylate (PubChem CID 135754072) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is ethyl 5-[(2E)-2-(2,4-dihydroxyphenyl)-2-hydroxyiminoethyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[(2E)-2-(2,4-dihydroxyphenyl)-2-hydroxyiminoethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 135754072 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | ethyl 5-[(2E)-2-(2,4-dihydroxyphenyl)-2-hydroxyiminoethyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C/C(=N\O)c2ccc(O)cc2O)o1 |
| InChI | InChI=1S/C15H15NO6/c1-2-21-15(19)14-6-4-10(22-14)8-12(16-20)11-5-3-9(17)7-13(11)18/h3-7,17-18,20H,2,8H2,1H3/b16-12+ |
| InChIKey | FXMZORIQNOXYIA-FOWTUZBSSA-N |
| XLogP | 2.29 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|