C23H17ClN4O2S — CID 135754217
4-chloro-11-(2-methoxyphenyl)-9-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 135754217) has the molecular formula C23H17ClN4O2S and a molecular weight of 448.94 g/mol. Its IUPAC name is 4-chloro-11-(2-methoxyphenyl)-9-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | 4-chloro-11-(2-methoxyphenyl)-9-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 135754217 |
| Molecular Formula | C23H17ClN4O2S |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4-chloro-11-(2-methoxyphenyl)-9-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | COc1ccccc1C1C2=C(Nc3ncnn31)c1cc(Cl)ccc1OC2c1cccs1 |
| InChI | InChI=1S/C23H17ClN4O2S/c1-29-16-6-3-2-5-14(16)21-19-20(27-23-25-12-26-28(21)23)15-11-13(24)8-9-17(15)30-22(19)18-7-4-10-31-18/h2-12,21-22H,1H3,(H,25,26,27) |
| InChIKey | IIABCXAQRXQWLR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |