C22H14ClFN4OS — CID 136722976
(9R,11R)-4-chloro-9-(3-fluorophenyl)-11-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 136722976) has the molecular formula C22H14ClFN4OS and a molecular weight of 436.90 g/mol. Its IUPAC name is (9R,11R)-4-chloro-9-(3-fluorophenyl)-11-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9R,11R)-4-chloro-9-(3-fluorophenyl)-11-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 136722976 |
| Molecular Formula | C22H14ClFN4OS |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | (9R,11R)-4-chloro-9-(3-fluorophenyl)-11-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Fc1cccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccs2)n2ncnc2N3)c1 |
| InChI | InChI=1S/C22H14ClFN4OS/c23-13-6-7-16-15(10-13)19-18(21(29-16)12-3-1-4-14(24)9-12)20(17-5-2-8-30-17)28-22(27-19)25-11-26-28/h1-11,20-21H,(H,25,26,27)/t20-,21+/m0/s1 |
| InChIKey | DULQRBLQAKSTLV-LEWJYISDSA-N |
| XLogP | 5.69 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |