C24H19ClN4O3S — CID 3783659
4-chloro-9-(3,4-dimethoxyphenyl)-11-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 3783659) has the molecular formula C24H19ClN4O3S and a molecular weight of 478.96 g/mol. Its IUPAC name is 4-chloro-9-(3,4-dimethoxyphenyl)-11-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | 4-chloro-9-(3,4-dimethoxyphenyl)-11-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 3783659 |
| Molecular Formula | C24H19ClN4O3S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 4-chloro-9-(3,4-dimethoxyphenyl)-11-thiophen-2-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | COc1ccc(C2Oc3ccc(Cl)cc3C3=C2C(c2cccs2)n2ncnc2N3)cc1OC |
| InChI | InChI=1S/C24H19ClN4O3S/c1-30-17-7-5-13(10-18(17)31-2)23-20-21(15-11-14(25)6-8-16(15)32-23)28-24-26-12-27-29(24)22(20)19-4-3-9-33-19/h3-12,22-23H,1-2H3,(H,26,27,28) |
| InChIKey | UPFFEFTWYMTOKW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |